C17H26F2O6S2 — CID 123333754
difluoro-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]sulfonylmethanesulfonic acid (PubChem CID 123333754) has the molecular formula C17H26F2O6S2 and a molecular weight of 428.52 g/mol. Its IUPAC name is difluoro-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]sulfonylmethanesulfonic acid.
| Compound Name | difluoro-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]sulfonylmethanesulfonic acid |
|---|---|
| PubChem CID | 123333754 |
| Molecular Formula | C17H26F2O6S2 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | difluoro-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]sulfonylmethanesulfonic acid |
| SMILES | CC(C)(C)CC(c1ccc(OS(=O)(=O)C(F)(F)S(=O)(=O)O)cc1)C(C)(C)C |
| InChI | InChI=1S/C17H26F2O6S2/c1-15(2,3)11-14(16(4,5)6)12-7-9-13(10-8-12)25-27(23,24)17(18,19)26(20,21)22/h7-10,14H,11H2,1-6H3,(H,20,21,22) |
| InChIKey | MMNCAPSJXHZYHV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|