C23H25F5O5 — CID 89078929
[6-[2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethoxy]naphthalen-2-yl]methyl 4,4-dimethylpentanoate (PubChem CID 89078929) has the molecular formula C23H25F5O5 and a molecular weight of 476.44 g/mol. Its IUPAC name is [6-[2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethoxy]naphthalen-2-yl]methyl 4,4-dimethylpentanoate.
| Compound Name | [6-[2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethoxy]naphthalen-2-yl]methyl 4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 89078929 |
| Molecular Formula | C23H25F5O5 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | [6-[2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethoxy]naphthalen-2-yl]methyl 4,4-dimethylpentanoate |
| SMILES | CC(C)(C)CCC(=O)OCc1ccc2cc(OCC(=O)OCC(F)(F)C(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C23H25F5O5/c1-21(2,3)9-8-19(29)32-12-15-4-5-17-11-18(7-6-16(17)10-15)31-13-20(30)33-14-22(24,25)23(26,27)28/h4-7,10-11H,8-9,12-14H2,1-3H3 |
| InChIKey | KJOLRVMMTSWNQN-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|