C14H12ClF5O4 — CID 91717851
4-O-(4-chloro-3-methylphenyl) 1-O-(2,2,3,3,3-pentafluoropropyl) butanedioate (PubChem CID 91717851) has the molecular formula C14H12ClF5O4 and a molecular weight of 374.69 g/mol. Its IUPAC name is 4-O-(4-chloro-3-methylphenyl) 1-O-(2,2,3,3,3-pentafluoropropyl) butanedioate.
| Compound Name | 4-O-(4-chloro-3-methylphenyl) 1-O-(2,2,3,3,3-pentafluoropropyl) butanedioate |
|---|---|
| PubChem CID | 91717851 |
| Molecular Formula | C14H12ClF5O4 |
| Molecular Weight | 374.69 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 4-O-(4-chloro-3-methylphenyl) 1-O-(2,2,3,3,3-pentafluoropropyl) butanedioate |
| SMILES | Cc1cc(OC(=O)CCC(=O)OCC(F)(F)C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C14H12ClF5O4/c1-8-6-9(2-3-10(8)15)24-12(22)5-4-11(21)23-7-13(16,17)14(18,19)20/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | HUQZOAINGHJAEL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.69 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|