C16H19ClO4 — CID 91695184
1-O-(4-chloro-3-methylphenyl) 4-O-pent-4-en-2-yl butanedioate (PubChem CID 91695184) has the molecular formula C16H19ClO4 and a molecular weight of 310.78 g/mol. Its IUPAC name is 1-O-(4-chloro-3-methylphenyl) 4-O-pent-4-en-2-yl butanedioate.
| Compound Name | 1-O-(4-chloro-3-methylphenyl) 4-O-pent-4-en-2-yl butanedioate |
|---|---|
| PubChem CID | 91695184 |
| Molecular Formula | C16H19ClO4 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-O-(4-chloro-3-methylphenyl) 4-O-pent-4-en-2-yl butanedioate |
| SMILES | C=CCC(C)OC(=O)CCC(=O)Oc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C16H19ClO4/c1-4-5-12(3)20-15(18)8-9-16(19)21-13-6-7-14(17)11(2)10-13/h4,6-7,10,12H,1,5,8-9H2,2-3H3 |
| InChIKey | KGHVXEJBUKAHJP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|