C22H28IO2- — CID 59503192
1-[1-(2-cyclohexylethoxy)ethoxy]-4-phenyliodanuidylbenzene (PubChem CID 59503192) has the molecular formula C22H28IO2- and a molecular weight of 451.37 g/mol. Its IUPAC name is 1-[1-(2-cyclohexylethoxy)ethoxy]-4-phenyliodanuidylbenzene.
| Compound Name | 1-[1-(2-cyclohexylethoxy)ethoxy]-4-phenyliodanuidylbenzene |
|---|---|
| PubChem CID | 59503192 |
| Molecular Formula | C22H28IO2- |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 1-[1-(2-cyclohexylethoxy)ethoxy]-4-phenyliodanuidylbenzene |
| SMILES | CC(OCCC1CCCCC1)Oc1ccc([I-]c2ccccc2)cc1 |
| InChI | InChI=1S/C22H28IO2/c1-18(24-17-16-19-8-4-2-5-9-19)25-22-14-12-21(13-15-22)23-20-10-6-3-7-11-20/h3,6-7,10-15,18-19H,2,4-5,8-9,16-17H2,1H3/q-1 |
| InChIKey | DCBHPCUEGXWQGC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|