C18H29N — CID 43484998
1-(4-cyclohexylphenyl)-N,3-dimethylbutan-1-amine (PubChem CID 43484998) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is 1-(4-cyclohexylphenyl)-N,3-dimethylbutan-1-amine.
| Compound Name | 1-(4-cyclohexylphenyl)-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 43484998 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 1-(4-cyclohexylphenyl)-N,3-dimethylbutan-1-amine |
| SMILES | CNC(CC(C)C)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H29N/c1-14(2)13-18(19-3)17-11-9-16(10-12-17)15-7-5-4-6-8-15/h9-12,14-15,18-19H,4-8,13H2,1-3H3 |
| InChIKey | ZMNPPBIUBJYRIC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |