C15H24N2 — CID 116954314
1-(4-cyclohexylphenyl)-N,N'-dimethylmethanediamine (PubChem CID 116954314) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-(4-cyclohexylphenyl)-N,N'-dimethylmethanediamine.
| Compound Name | 1-(4-cyclohexylphenyl)-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 116954314 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 1-(4-cyclohexylphenyl)-N,N'-dimethylmethanediamine |
| SMILES | CNC(NC)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C15H24N2/c1-16-15(17-2)14-10-8-13(9-11-14)12-6-4-3-5-7-12/h8-12,15-17H,3-7H2,1-2H3 |
| InChIKey | QNCMQJKAUBWWDP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|