C24H40O2 — CID 123735194
1-(1-cyclohexyloxy-2-methylpropoxy)-4-(2,2,4-trimethylpentan-3-yl)benzene (PubChem CID 123735194) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is 1-(1-cyclohexyloxy-2-methylpropoxy)-4-(2,2,4-trimethylpentan-3-yl)benzene.
| Compound Name | 1-(1-cyclohexyloxy-2-methylpropoxy)-4-(2,2,4-trimethylpentan-3-yl)benzene |
|---|---|
| PubChem CID | 123735194 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | 1-(1-cyclohexyloxy-2-methylpropoxy)-4-(2,2,4-trimethylpentan-3-yl)benzene |
| SMILES | CC(C)C(Oc1ccc(C(C(C)C)C(C)(C)C)cc1)OC1CCCCC1 |
| InChI | InChI=1S/C24H40O2/c1-17(2)22(24(5,6)7)19-13-15-21(16-14-19)26-23(18(3)4)25-20-11-9-8-10-12-20/h13-18,20,22-23H,8-12H2,1-7H3 |
| InChIKey | HSFKKFCCMWKLSE-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|