C35H60O2 — CID 123971759
1-[2-(1-cyclohexylcyclohexyl)-1-[(2-methylpropan-2-yl)oxy]ethoxy]-4-(2,2,5,5-tetramethylheptan-4-yl)benzene (PubChem CID 123971759) has the molecular formula C35H60O2 and a molecular weight of 512.86 g/mol. Its IUPAC name is 1-[2-(1-cyclohexylcyclohexyl)-1-[(2-methylpropan-2-yl)oxy]ethoxy]-4-(2,2,5,5-tetramethylheptan-4-yl)benzene.
| Compound Name | 1-[2-(1-cyclohexylcyclohexyl)-1-[(2-methylpropan-2-yl)oxy]ethoxy]-4-(2,2,5,5-tetramethylheptan-4-yl)benzene |
|---|---|
| PubChem CID | 123971759 |
| Molecular Formula | C35H60O2 |
| Molecular Weight | 512.86 g/mol |
| Exact Mass | 512.46 |
| IUPAC Name | 1-[2-(1-cyclohexylcyclohexyl)-1-[(2-methylpropan-2-yl)oxy]ethoxy]-4-(2,2,5,5-tetramethylheptan-4-yl)benzene |
| SMILES | CCC(C)(C)C(CC(C)(C)C)c1ccc(OC(CC2(C3CCCCC3)CCCCC2)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C35H60O2/c1-10-34(8,9)30(25-32(2,3)4)27-19-21-29(22-20-27)36-31(37-33(5,6)7)26-35(23-15-12-16-24-35)28-17-13-11-14-18-28/h19-22,28,30-31H,10-18,23-26H2,1-9H3 |
| InChIKey | VVIOCRKPIBRNJS-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.86 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|