C23H30O7 — CID 57190095
3,3-bis[4-(1-ethoxyethoxy)phenyl]-2-hydroxypropanoic acid (PubChem CID 57190095) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is 3,3-bis[4-(1-ethoxyethoxy)phenyl]-2-hydroxypropanoic acid.
| Compound Name | 3,3-bis[4-(1-ethoxyethoxy)phenyl]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 57190095 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 3,3-bis[4-(1-ethoxyethoxy)phenyl]-2-hydroxypropanoic acid |
| SMILES | CCOC(C)Oc1ccc(C(c2ccc(OC(C)OCC)cc2)C(O)C(=O)O)cc1 |
| InChI | InChI=1S/C23H30O7/c1-5-27-15(3)29-19-11-7-17(8-12-19)21(22(24)23(25)26)18-9-13-20(14-10-18)30-16(4)28-6-2/h7-16,21-22,24H,5-6H2,1-4H3,(H,25,26) |
| InChIKey | STPYRJACNJXRTL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|