C22H32O — CID 145059782
1-(2,2-dimethylhexan-3-yl)-4-phenoxybenzene;ethane (PubChem CID 145059782) has the molecular formula C22H32O and a molecular weight of 312.50 g/mol. Its IUPAC name is 1-(2,2-dimethylhexan-3-yl)-4-phenoxybenzene;ethane.
| Compound Name | 1-(2,2-dimethylhexan-3-yl)-4-phenoxybenzene;ethane |
|---|---|
| PubChem CID | 145059782 |
| Molecular Formula | C22H32O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 1-(2,2-dimethylhexan-3-yl)-4-phenoxybenzene;ethane |
| SMILES | CC.CCCC(c1ccc(Oc2ccccc2)cc1)C(C)(C)C |
| InChI | InChI=1S/C20H26O.C2H6/c1-5-9-19(20(2,3)4)16-12-14-18(15-13-16)21-17-10-7-6-8-11-17;1-2/h6-8,10-15,19H,5,9H2,1-4H3;1-2H3 |
| InChIKey | RDUQABBYTSRXEI-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |