C18H28O2 — CID 144772257
2-[[4-(2,2-dimethylhexan-3-yl)phenyl]methoxymethyl]oxirane (PubChem CID 144772257) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-[[4-(2,2-dimethylhexan-3-yl)phenyl]methoxymethyl]oxirane.
| Compound Name | 2-[[4-(2,2-dimethylhexan-3-yl)phenyl]methoxymethyl]oxirane |
|---|---|
| PubChem CID | 144772257 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 2-[[4-(2,2-dimethylhexan-3-yl)phenyl]methoxymethyl]oxirane |
| SMILES | CCCC(c1ccc(COCC2CO2)cc1)C(C)(C)C |
| InChI | InChI=1S/C18H28O2/c1-5-6-17(18(2,3)4)15-9-7-14(8-10-15)11-19-12-16-13-20-16/h7-10,16-17H,5-6,11-13H2,1-4H3 |
| InChIKey | XBVOPNZSEPXVPX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|