C19H30O2 — CID 144895913
2-[[4-(2,2,5-trimethylhexan-3-yl)phenyl]methoxymethyl]oxirane (PubChem CID 144895913) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-[[4-(2,2,5-trimethylhexan-3-yl)phenyl]methoxymethyl]oxirane.
| Compound Name | 2-[[4-(2,2,5-trimethylhexan-3-yl)phenyl]methoxymethyl]oxirane |
|---|---|
| PubChem CID | 144895913 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-[[4-(2,2,5-trimethylhexan-3-yl)phenyl]methoxymethyl]oxirane |
| SMILES | CC(C)CC(c1ccc(COCC2CO2)cc1)C(C)(C)C |
| InChI | InChI=1S/C19H30O2/c1-14(2)10-18(19(3,4)5)16-8-6-15(7-9-16)11-20-12-17-13-21-17/h6-9,14,17-18H,10-13H2,1-5H3 |
| InChIKey | OHMFBUBEMUMNBO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|