C15H12F10O4 — CID 118037281
2-[[4-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]phenyl]methoxymethyl]oxirane (PubChem CID 118037281) has the molecular formula C15H12F10O4 and a molecular weight of 446.24 g/mol. Its IUPAC name is 2-[[4-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]phenyl]methoxymethyl]oxirane.
| Compound Name | 2-[[4-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]phenyl]methoxymethyl]oxirane |
|---|---|
| PubChem CID | 118037281 |
| Molecular Formula | C15H12F10O4 |
| Molecular Weight | 446.24 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 2-[[4-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]phenyl]methoxymethyl]oxirane |
| SMILES | FC(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)Oc1ccc(COCC2CO2)cc1 |
| InChI | InChI=1S/C15H12F10O4/c16-11(29-15(24,25)13(19,20)14(21,22)23)12(17,18)28-9-3-1-8(2-4-9)5-26-6-10-7-27-10/h1-4,10-11H,5-7H2 |
| InChIKey | ROOLTYIIJPWRJY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.24 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|