C21H30N+ — CID 143647365
1-[[4-(2,2,5-trimethylhexan-3-yl)phenyl]methyl]pyridin-1-ium (PubChem CID 143647365) has the molecular formula C21H30N+ and a molecular weight of 296.48 g/mol. Its IUPAC name is 1-[[4-(2,2,5-trimethylhexan-3-yl)phenyl]methyl]pyridin-1-ium.
| Compound Name | 1-[[4-(2,2,5-trimethylhexan-3-yl)phenyl]methyl]pyridin-1-ium |
|---|---|
| PubChem CID | 143647365 |
| Molecular Formula | C21H30N+ |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | 1-[[4-(2,2,5-trimethylhexan-3-yl)phenyl]methyl]pyridin-1-ium |
| SMILES | CC(C)CC(c1ccc(C[n+]2ccccc2)cc1)C(C)(C)C |
| InChI | InChI=1S/C21H30N/c1-17(2)15-20(21(3,4)5)19-11-9-18(10-12-19)16-22-13-7-6-8-14-22/h6-14,17,20H,15-16H2,1-5H3/q+1 |
| InChIKey | DGBCMADLPADENQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|