C19H32 — CID 144677187
1-propan-2-yl-4-(2,2,5-trimethylheptan-3-yl)benzene (PubChem CID 144677187) has the molecular formula C19H32 and a molecular weight of 260.47 g/mol. Its IUPAC name is 1-propan-2-yl-4-(2,2,5-trimethylheptan-3-yl)benzene.
| Compound Name | 1-propan-2-yl-4-(2,2,5-trimethylheptan-3-yl)benzene |
|---|---|
| PubChem CID | 144677187 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.47 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | 1-propan-2-yl-4-(2,2,5-trimethylheptan-3-yl)benzene |
| SMILES | CCC(C)CC(c1ccc(C(C)C)cc1)C(C)(C)C |
| InChI | InChI=1S/C19H32/c1-8-15(4)13-18(19(5,6)7)17-11-9-16(10-12-17)14(2)3/h9-12,14-15,18H,8,13H2,1-7H3 |
| InChIKey | MQJSMZRVQMYDFR-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.47 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |