C18H29Br — CID 114876117
1-(1-bromo-3-methylpentyl)-2,4-di(propan-2-yl)benzene (PubChem CID 114876117) has the molecular formula C18H29Br and a molecular weight of 325.33 g/mol. Its IUPAC name is 1-(1-bromo-3-methylpentyl)-2,4-di(propan-2-yl)benzene.
| Compound Name | 1-(1-bromo-3-methylpentyl)-2,4-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 114876117 |
| Molecular Formula | C18H29Br |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-(1-bromo-3-methylpentyl)-2,4-di(propan-2-yl)benzene |
| SMILES | CCC(C)CC(Br)c1ccc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C18H29Br/c1-7-14(6)10-18(19)16-9-8-15(12(2)3)11-17(16)13(4)5/h8-9,11-14,18H,7,10H2,1-6H3 |
| InChIKey | JOYXJYUATZWOCF-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|