C19H24BrN — CID 43110162
(4-bromophenyl)-[2,4-di(propan-2-yl)phenyl]methanamine (PubChem CID 43110162) has the molecular formula C19H24BrN and a molecular weight of 346.31 g/mol. Its IUPAC name is (4-bromophenyl)-[2,4-di(propan-2-yl)phenyl]methanamine.
| Compound Name | (4-bromophenyl)-[2,4-di(propan-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 43110162 |
| Molecular Formula | C19H24BrN |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (4-bromophenyl)-[2,4-di(propan-2-yl)phenyl]methanamine |
| SMILES | CC(C)c1ccc(C(N)c2ccc(Br)cc2)c(C(C)C)c1 |
| InChI | InChI=1S/C19H24BrN/c1-12(2)15-7-10-17(18(11-15)13(3)4)19(21)14-5-8-16(20)9-6-14/h5-13,19H,21H2,1-4H3 |
| InChIKey | PFFSXLUHXVBQFY-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |