C14H15BrN2O — CID 82525499
3-[amino-(4-bromophenyl)methyl]-1,6-dimethylpyridin-2-one (PubChem CID 82525499) has the molecular formula C14H15BrN2O and a molecular weight of 307.19 g/mol. Its IUPAC name is 3-[amino-(4-bromophenyl)methyl]-1,6-dimethylpyridin-2-one.
| Compound Name | 3-[amino-(4-bromophenyl)methyl]-1,6-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 82525499 |
| Molecular Formula | C14H15BrN2O |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 3-[amino-(4-bromophenyl)methyl]-1,6-dimethylpyridin-2-one |
| SMILES | Cc1ccc(C(N)c2ccc(Br)cc2)c(=O)n1C |
| InChI | InChI=1S/C14H15BrN2O/c1-9-3-8-12(14(18)17(9)2)13(16)10-4-6-11(15)7-5-10/h3-8,13H,16H2,1-2H3 |
| InChIKey | OZNKBQAQSPVLSV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |