C33H37ClN+ — CID 58454581
1-[[4-[4-[4-(chloromethyl)phenyl]-6-phenyloctan-2-yl]phenyl]methyl]pyridin-1-ium (PubChem CID 58454581) has the molecular formula C33H37ClN+ and a molecular weight of 483.12 g/mol. Its IUPAC name is 1-[[4-[4-[4-(chloromethyl)phenyl]-6-phenyloctan-2-yl]phenyl]methyl]pyridin-1-ium.
| Compound Name | 1-[[4-[4-[4-(chloromethyl)phenyl]-6-phenyloctan-2-yl]phenyl]methyl]pyridin-1-ium |
|---|---|
| PubChem CID | 58454581 |
| Molecular Formula | C33H37ClN+ |
| Molecular Weight | 483.12 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 1-[[4-[4-[4-(chloromethyl)phenyl]-6-phenyloctan-2-yl]phenyl]methyl]pyridin-1-ium |
| SMILES | CCC(CC(CC(C)c1ccc(C[n+]2ccccc2)cc1)c1ccc(CCl)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H37ClN/c1-3-29(31-10-6-4-7-11-31)23-33(32-18-12-27(24-34)13-19-32)22-26(2)30-16-14-28(15-17-30)25-35-20-8-5-9-21-35/h4-21,26,29,33H,3,22-25H2,1-2H3/q+1 |
| InChIKey | SUPYNQODISAZQF-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.12 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|