C29H34ClI — CID 20677144
1-(chloromethyl)-4-[7-(4-iodophenyl)-2,2-dimethyl-5-phenyloctan-3-yl]benzene (PubChem CID 20677144) has the molecular formula C29H34ClI and a molecular weight of 544.95 g/mol. Its IUPAC name is 1-(chloromethyl)-4-[7-(4-iodophenyl)-2,2-dimethyl-5-phenyloctan-3-yl]benzene.
| Compound Name | 1-(chloromethyl)-4-[7-(4-iodophenyl)-2,2-dimethyl-5-phenyloctan-3-yl]benzene |
|---|---|
| PubChem CID | 20677144 |
| Molecular Formula | C29H34ClI |
| Molecular Weight | 544.95 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 1-(chloromethyl)-4-[7-(4-iodophenyl)-2,2-dimethyl-5-phenyloctan-3-yl]benzene |
| SMILES | CC(CC(CC(c1ccc(CCl)cc1)C(C)(C)C)c1ccccc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C29H34ClI/c1-21(23-14-16-27(31)17-15-23)18-26(24-8-6-5-7-9-24)19-28(29(2,3)4)25-12-10-22(20-30)11-13-25/h5-17,21,26,28H,18-20H2,1-4H3 |
| InChIKey | MDERGZUGNZNNHV-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.95 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|