C41H46O3 — CID 22952737
[4-[[4-[2,2-dimethyl-5-phenyl-7-(4-prop-1-ynylphenyl)octan-3-yl]phenyl]methoxy]phenyl]methyl acetate (PubChem CID 22952737) has the molecular formula C41H46O3 and a molecular weight of 586.82 g/mol. Its IUPAC name is [4-[[4-[2,2-dimethyl-5-phenyl-7-(4-prop-1-ynylphenyl)octan-3-yl]phenyl]methoxy]phenyl]methyl acetate.
| Compound Name | [4-[[4-[2,2-dimethyl-5-phenyl-7-(4-prop-1-ynylphenyl)octan-3-yl]phenyl]methoxy]phenyl]methyl acetate |
|---|---|
| PubChem CID | 22952737 |
| Molecular Formula | C41H46O3 |
| Molecular Weight | 586.82 g/mol |
| Exact Mass | 586.34 |
| IUPAC Name | [4-[[4-[2,2-dimethyl-5-phenyl-7-(4-prop-1-ynylphenyl)octan-3-yl]phenyl]methoxy]phenyl]methyl acetate |
| SMILES | CC#Cc1ccc(C(C)CC(CC(c2ccc(COc3ccc(COC(C)=O)cc3)cc2)C(C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C41H46O3/c1-7-11-32-14-20-35(21-15-32)30(2)26-38(36-12-9-8-10-13-36)27-40(41(4,5)6)37-22-16-33(17-23-37)29-44-39-24-18-34(19-25-39)28-43-31(3)42/h8-10,12-25,30,38,40H,26-29H2,1-6H3 |
| InChIKey | HCBCQOLKORLOFF-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.82 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|