C37H44O6S — CID 177097782
4-[[4-[5-(4-hydroxyphenyl)-7-[4-[(2-methylpropan-2-yl)oxy]phenyl]octan-3-yl]phenyl]methoxy]benzenesulfonic acid (PubChem CID 177097782) has the molecular formula C37H44O6S and a molecular weight of 616.82 g/mol. Its IUPAC name is 4-[[4-[5-(4-hydroxyphenyl)-7-[4-[(2-methylpropan-2-yl)oxy]phenyl]octan-3-yl]phenyl]methoxy]benzenesulfonic acid.
| Compound Name | 4-[[4-[5-(4-hydroxyphenyl)-7-[4-[(2-methylpropan-2-yl)oxy]phenyl]octan-3-yl]phenyl]methoxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 177097782 |
| Molecular Formula | C37H44O6S |
| Molecular Weight | 616.82 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | 4-[[4-[5-(4-hydroxyphenyl)-7-[4-[(2-methylpropan-2-yl)oxy]phenyl]octan-3-yl]phenyl]methoxy]benzenesulfonic acid |
| SMILES | CCC(CC(CC(C)c1ccc(OC(C)(C)C)cc1)c1ccc(O)cc1)c1ccc(COc2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C37H44O6S/c1-6-28(30-9-7-27(8-10-30)25-42-34-19-21-36(22-20-34)44(39,40)41)24-32(31-11-15-33(38)16-12-31)23-26(2)29-13-17-35(18-14-29)43-37(3,4)5/h7-22,26,28,32,38H,6,23-25H2,1-5H3,(H,39,40,41) |
| InChIKey | GBIXMNMUACVDOD-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.82 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|