C39H52O3 — CID 162237214
1-butan-2-yl-4-(1-methoxy-2-methylpropoxy)benzene;4-butan-2-ylphenol;1,2-dimethyl-1,2-dihydroacenaphthylene (PubChem CID 162237214) has the molecular formula C39H52O3 and a molecular weight of 568.84 g/mol. Its IUPAC name is 1-butan-2-yl-4-(1-methoxy-2-methylpropoxy)benzene;4-butan-2-ylphenol;1,2-dimethyl-1,2-dihydroacenaphthylene.
| Compound Name | 1-butan-2-yl-4-(1-methoxy-2-methylpropoxy)benzene;4-butan-2-ylphenol;1,2-dimethyl-1,2-dihydroacenaphthylene |
|---|---|
| PubChem CID | 162237214 |
| Molecular Formula | C39H52O3 |
| Molecular Weight | 568.84 g/mol |
| Exact Mass | 568.39 |
| IUPAC Name | 1-butan-2-yl-4-(1-methoxy-2-methylpropoxy)benzene;4-butan-2-ylphenol;1,2-dimethyl-1,2-dihydroacenaphthylene |
| SMILES | CC1c2cccc3cccc(c23)C1C.CCC(C)c1ccc(O)cc1.CCC(C)c1ccc(OC(OC)C(C)C)cc1 |
| InChI | InChI=1S/C15H24O2.C14H14.C10H14O/c1-6-12(4)13-7-9-14(10-8-13)17-15(16-5)11(2)3;1-9-10(2)13-8-4-6-11-5-3-7-12(9)14(11)13;1-3-8(2)9-4-6-10(11)7-5-9/h7-12,15H,6H2,1-5H3;3-10H,1-2H3;4-8,11H,3H2,1-2H3 |
| InChIKey | ZWFIYEWQVWECRP-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.84 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|