C42H52O3P+ — CID 172783037
[2,3-bis[3,6-di(butan-2-yl)naphthalen-2-yl]phenyl]-trihydroxyphosphanium (PubChem CID 172783037) has the molecular formula C42H52O3P+ and a molecular weight of 635.85 g/mol. Its IUPAC name is [2,3-bis[3,6-di(butan-2-yl)naphthalen-2-yl]phenyl]-trihydroxyphosphanium.
| Compound Name | [2,3-bis[3,6-di(butan-2-yl)naphthalen-2-yl]phenyl]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 172783037 |
| Molecular Formula | C42H52O3P+ |
| Molecular Weight | 635.85 g/mol |
| Exact Mass | 635.36 |
| IUPAC Name | [2,3-bis[3,6-di(butan-2-yl)naphthalen-2-yl]phenyl]-trihydroxyphosphanium |
| SMILES | CCC(C)c1ccc2cc(-c3cccc([P+](O)(O)O)c3-c3cc4ccc(C(C)CC)cc4cc3C(C)CC)c(C(C)CC)cc2c1 |
| InChI | InChI=1S/C42H52O3P/c1-9-26(5)30-16-18-32-22-39(37(28(7)11-3)24-34(32)20-30)36-14-13-15-41(46(43,44)45)42(36)40-23-33-19-17-31(27(6)10-2)21-35(33)25-38(40)29(8)12-4/h13-29,43-45H,9-12H2,1-8H3/q+1 |
| InChIKey | YTVPZAUANDPTJS-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.85 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|