C15H16O2 — CID 142309916
6-butan-2-ylbenzo[f][1,3]benzodioxole (PubChem CID 142309916) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 6-butan-2-ylbenzo[f][1,3]benzodioxole.
| Compound Name | 6-butan-2-ylbenzo[f][1,3]benzodioxole |
|---|---|
| PubChem CID | 142309916 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 6-butan-2-ylbenzo[f][1,3]benzodioxole |
| SMILES | CCC(C)c1ccc2cc3c(cc2c1)OCO3 |
| InChI | InChI=1S/C15H16O2/c1-3-10(2)11-4-5-12-7-14-15(17-9-16-14)8-13(12)6-11/h4-8,10H,3,9H2,1-2H3 |
| InChIKey | RPVQBYAEMGYGEE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |