C23H30O4 — CID 118048664
5-[[1-(4-butan-2-ylphenoxy)-3-methylbutoxy]methyl]-1,3-benzodioxole (PubChem CID 118048664) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 5-[[1-(4-butan-2-ylphenoxy)-3-methylbutoxy]methyl]-1,3-benzodioxole.
| Compound Name | 5-[[1-(4-butan-2-ylphenoxy)-3-methylbutoxy]methyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 118048664 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 5-[[1-(4-butan-2-ylphenoxy)-3-methylbutoxy]methyl]-1,3-benzodioxole |
| SMILES | CCC(C)c1ccc(OC(CC(C)C)OCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C23H30O4/c1-5-17(4)19-7-9-20(10-8-19)27-23(12-16(2)3)24-14-18-6-11-21-22(13-18)26-15-25-21/h6-11,13,16-17,23H,5,12,14-15H2,1-4H3 |
| InChIKey | HNYSCWDDMDWBHL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|