C20H30O2 — CID 59409220
2-cyclohexylpropan-2-yl 3-butan-2-ylbenzoate (PubChem CID 59409220) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 2-cyclohexylpropan-2-yl 3-butan-2-ylbenzoate.
| Compound Name | 2-cyclohexylpropan-2-yl 3-butan-2-ylbenzoate |
|---|---|
| PubChem CID | 59409220 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 2-cyclohexylpropan-2-yl 3-butan-2-ylbenzoate |
| SMILES | CCC(C)c1cccc(C(=O)OC(C)(C)C2CCCCC2)c1 |
| InChI | InChI=1S/C20H30O2/c1-5-15(2)16-10-9-11-17(14-16)19(21)22-20(3,4)18-12-7-6-8-13-18/h9-11,14-15,18H,5-8,12-13H2,1-4H3 |
| InChIKey | JQONHZQSKQFWJU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |