About 2-(4-fluoro-3-hydroxyphenyl)propan-2-yl 4-butan-2-ylbenzoate
2-(4-fluoro-3-hydroxyphenyl)propan-2-yl 4-butan-2-ylbenzoate (PubChem CID 170374088) has the molecular formula C20H23FO3
and a molecular weight of 330.40 g/mol. Its IUPAC name is 2-(4-fluoro-3-hydroxyphenyl)propan-2-yl 4-butan-2-ylbenzoate.
Molecular Properties
| Compound Name | 2-(4-fluoro-3-hydroxyphenyl)propan-2-yl 4-butan-2-ylbenzoate |
| PubChem CID | 170374088 |
| Molecular Formula | C20H23FO3 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-(4-fluoro-3-hydroxyphenyl)propan-2-yl 4-butan-2-ylbenzoate |
| SMILES | CCC(C)c1ccc(C(=O)OC(C)(C)c2ccc(F)c(O)c2)cc1 |
| InChI | InChI=1S/C20H23FO3/c1-5-13(2)14-6-8-15(9-7-14)19(23)24-20(3,4)16-10-11-17(21)18(22)12-16/h6-13,22H,5H2,1-4H3 |
| InChIKey | JABJRISHCYLOQU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-fluoro-3-hydroxyphenyl)propan-2-yl 4-butan-2-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluoro-3-hydroxyphenyl)propan-2-yl 4-butan-2-ylbenzoate?
The IUPAC name of 2-(4-fluoro-3-hydroxyphenyl)propan-2-yl 4-butan-2-ylbenzoate (CID 170374088) is 2-(4-fluoro-3-hydroxyphenyl)propan-2-yl 4-butan-2-ylbenzoate.
What is the SMILES notation for 2-(4-fluoro-3-hydroxyphenyl)propan-2-yl 4-butan-2-ylbenzoate?
The canonical SMILES for 2-(4-fluoro-3-hydroxyphenyl)propan-2-yl 4-butan-2-ylbenzoate is CCC(C)c1ccc(C(=O)OC(C)(C)c2ccc(F)c(O)c2)cc1.
What is the InChIKey of 2-(4-fluoro-3-hydroxyphenyl)propan-2-yl 4-butan-2-ylbenzoate?
The InChIKey is JABJRISHCYLOQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23FO3/c1-5-13(2)14-6-8-15(9-7-14)19(23)24-20(3,4)16-10-11-17(21)18(22)12-16/h6-13,22H,5H2,1-4H3.
What are the key properties of 2-(4-fluoro-3-hydroxyphenyl)propan-2-yl 4-butan-2-ylbenzoate?
2-(4-fluoro-3-hydroxyphenyl)propan-2-yl 4-butan-2-ylbenzoate has a molecular weight of 330.40 g/mol, XLogP of 5.14, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluoro-3-hydroxyphenyl)propan-2-yl 4-butan-2-ylbenzoate is sourced from PubChem (CID 170374088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).