C17H22NO5P — CID 167620591
tert-butyl 5-[ethoxy(methyl)phosphoryl]carbonyl-1H-indole-2-carboxylate (PubChem CID 167620591) has the molecular formula C17H22NO5P and a molecular weight of 351.34 g/mol. Its IUPAC name is tert-butyl 5-[ethoxy(methyl)phosphoryl]carbonyl-1H-indole-2-carboxylate.
| Compound Name | tert-butyl 5-[ethoxy(methyl)phosphoryl]carbonyl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 167620591 |
| Molecular Formula | C17H22NO5P |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | tert-butyl 5-[ethoxy(methyl)phosphoryl]carbonyl-1H-indole-2-carboxylate |
| SMILES | CCOP(C)(=O)C(=O)c1ccc2[nH]c(C(=O)OC(C)(C)C)cc2c1 |
| InChI | InChI=1S/C17H22NO5P/c1-6-22-24(5,21)16(20)11-7-8-13-12(9-11)10-14(18-13)15(19)23-17(2,3)4/h7-10,18H,6H2,1-5H3 |
| InChIKey | FHEKYWCKDPGFPW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|