C14H18NO5P — CID 155170345
5-(diethoxyphosphorylmethyl)-1H-indole-2-carboxylic acid (PubChem CID 155170345) has the molecular formula C14H18NO5P and a molecular weight of 311.27 g/mol. Its IUPAC name is 5-(diethoxyphosphorylmethyl)-1H-indole-2-carboxylic acid.
| Compound Name | 5-(diethoxyphosphorylmethyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 155170345 |
| Molecular Formula | C14H18NO5P |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 5-(diethoxyphosphorylmethyl)-1H-indole-2-carboxylic acid |
| SMILES | CCOP(=O)(Cc1ccc2[nH]c(C(=O)O)cc2c1)OCC |
| InChI | InChI=1S/C14H18NO5P/c1-3-19-21(18,20-4-2)9-10-5-6-12-11(7-10)8-13(15-12)14(16)17/h5-8,15H,3-4,9H2,1-2H3,(H,16,17) |
| InChIKey | MOFSBFYPXCFWPQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|