C15H25F2NO6P2 — CID 10501969
2,6-bis[diethoxyphosphoryl(fluoro)methyl]pyridine (PubChem CID 10501969) has the molecular formula C15H25F2NO6P2 and a molecular weight of 415.31 g/mol. Its IUPAC name is 2,6-bis[diethoxyphosphoryl(fluoro)methyl]pyridine.
| Compound Name | 2,6-bis[diethoxyphosphoryl(fluoro)methyl]pyridine |
|---|---|
| PubChem CID | 10501969 |
| Molecular Formula | C15H25F2NO6P2 |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2,6-bis[diethoxyphosphoryl(fluoro)methyl]pyridine |
| SMILES | CCOP(=O)(OCC)C(F)c1cccc(C(F)P(=O)(OCC)OCC)n1 |
| InChI | InChI=1S/C15H25F2NO6P2/c1-5-21-25(19,22-6-2)14(16)12-10-9-11-13(18-12)15(17)26(20,23-7-3)24-8-4/h9-11,14-15H,5-8H2,1-4H3 |
| InChIKey | FKPQLNWJBNHVCF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|