C15H27NO6P2 — CID 11810977
2-[1,2-bis(diethoxyphosphoryl)ethyl]pyridine (PubChem CID 11810977) has the molecular formula C15H27NO6P2 and a molecular weight of 379.33 g/mol. Its IUPAC name is 2-[1,2-bis(diethoxyphosphoryl)ethyl]pyridine.
| Compound Name | 2-[1,2-bis(diethoxyphosphoryl)ethyl]pyridine |
|---|---|
| PubChem CID | 11810977 |
| Molecular Formula | C15H27NO6P2 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-[1,2-bis(diethoxyphosphoryl)ethyl]pyridine |
| SMILES | CCOP(=O)(CC(c1ccccn1)P(=O)(OCC)OCC)OCC |
| InChI | InChI=1S/C15H27NO6P2/c1-5-19-23(17,20-6-2)13-15(14-11-9-10-12-16-14)24(18,21-7-3)22-8-4/h9-12,15H,5-8,13H2,1-4H3 |
| InChIKey | YQNJQNJPSWNBHP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|