C17H8F6NO5P — CID 169170478
[fluoro-[6-(2,3,4,5,6-pentafluorophenoxy)carbonylquinolin-3-yl]methyl]phosphonic acid (PubChem CID 169170478) has the molecular formula C17H8F6NO5P and a molecular weight of 451.22 g/mol. Its IUPAC name is [fluoro-[6-(2,3,4,5,6-pentafluorophenoxy)carbonylquinolin-3-yl]methyl]phosphonic acid.
| Compound Name | [fluoro-[6-(2,3,4,5,6-pentafluorophenoxy)carbonylquinolin-3-yl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 169170478 |
| Molecular Formula | C17H8F6NO5P |
| Molecular Weight | 451.22 g/mol |
| Exact Mass | 451.00 |
| IUPAC Name | [fluoro-[6-(2,3,4,5,6-pentafluorophenoxy)carbonylquinolin-3-yl]methyl]phosphonic acid |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc2ncc(C(F)P(=O)(O)O)cc2c1 |
| InChI | InChI=1S/C17H8F6NO5P/c18-10-11(19)13(21)15(14(22)12(10)20)29-17(25)6-1-2-9-7(3-6)4-8(5-24-9)16(23)30(26,27)28/h1-5,16H,(H2,26,27,28) |
| InChIKey | KLOBBQLPUKTJHN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|