C20H22ClF5O3 — CID 143135030
ethane;(2,3,4,5,6-pentafluorophenyl) 3-chloro-4-propan-2-yloxybenzoate (PubChem CID 143135030) has the molecular formula C20H22ClF5O3 and a molecular weight of 440.84 g/mol. Its IUPAC name is ethane;(2,3,4,5,6-pentafluorophenyl) 3-chloro-4-propan-2-yloxybenzoate.
| Compound Name | ethane;(2,3,4,5,6-pentafluorophenyl) 3-chloro-4-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 143135030 |
| Molecular Formula | C20H22ClF5O3 |
| Molecular Weight | 440.84 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | ethane;(2,3,4,5,6-pentafluorophenyl) 3-chloro-4-propan-2-yloxybenzoate |
| SMILES | CC.CC.CC(C)Oc1ccc(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)cc1Cl |
| InChI | InChI=1S/C16H10ClF5O3.2C2H6/c1-6(2)24-9-4-3-7(5-8(9)17)16(23)25-15-13(21)11(19)10(18)12(20)14(15)22;2*1-2/h3-6H,1-2H3;2*1-2H3 |
| InChIKey | AZYVHHOZYBCVIW-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.84 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|