About acetonitrile;2-[(3-chloro-4-propan-2-yloxybenzoyl)amino]acetic acid;ethane
acetonitrile;2-[(3-chloro-4-propan-2-yloxybenzoyl)amino]acetic acid;ethane (PubChem CID 143134888) has the molecular formula C16H23ClN2O4
and a molecular weight of 342.82 g/mol. Its IUPAC name is acetonitrile;2-[(3-chloro-4-propan-2-yloxybenzoyl)amino]acetic acid;ethane.
Molecular Properties
| Compound Name | acetonitrile;2-[(3-chloro-4-propan-2-yloxybenzoyl)amino]acetic acid;ethane |
| PubChem CID | 143134888 |
| Molecular Formula | C16H23ClN2O4 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | acetonitrile;2-[(3-chloro-4-propan-2-yloxybenzoyl)amino]acetic acid;ethane |
| SMILES | CC.CC#N.CC(C)Oc1ccc(C(=O)NCC(=O)O)cc1Cl |
| InChI | InChI=1S/C12H14ClNO4.C2H3N.C2H6/c1-7(2)18-10-4-3-8(5-9(10)13)12(17)14-6-11(15)16;1-2-3;1-2/h3-5,7H,6H2,1-2H3,(H,14,17)(H,15,16);1H3;1-2H3 |
| InChIKey | LZHFEOJPWRPMIC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetonitrile;2-[(3-chloro-4-propan-2-yloxybenzoyl)amino]acetic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;2-[(3-chloro-4-propan-2-yloxybenzoyl)amino]acetic acid;ethane?
The IUPAC name of acetonitrile;2-[(3-chloro-4-propan-2-yloxybenzoyl)amino]acetic acid;ethane (CID 143134888) is acetonitrile;2-[(3-chloro-4-propan-2-yloxybenzoyl)amino]acetic acid;ethane.
What is the SMILES notation for acetonitrile;2-[(3-chloro-4-propan-2-yloxybenzoyl)amino]acetic acid;ethane?
The canonical SMILES for acetonitrile;2-[(3-chloro-4-propan-2-yloxybenzoyl)amino]acetic acid;ethane is CC.CC#N.CC(C)Oc1ccc(C(=O)NCC(=O)O)cc1Cl.
What is the InChIKey of acetonitrile;2-[(3-chloro-4-propan-2-yloxybenzoyl)amino]acetic acid;ethane?
The InChIKey is LZHFEOJPWRPMIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClNO4.C2H3N.C2H6/c1-7(2)18-10-4-3-8(5-9(10)13)12(17)14-6-11(15)16;1-2-3;1-2/h3-5,7H,6H2,1-2H3,(H,14,17)(H,15,16);1H3;1-2H3.
What are the key properties of acetonitrile;2-[(3-chloro-4-propan-2-yloxybenzoyl)amino]acetic acid;ethane?
acetonitrile;2-[(3-chloro-4-propan-2-yloxybenzoyl)amino]acetic acid;ethane has a molecular weight of 342.82 g/mol, XLogP of 3.50, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;2-[(3-chloro-4-propan-2-yloxybenzoyl)amino]acetic acid;ethane is sourced from PubChem (CID 143134888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).