C15H20ClNO3 — CID 143134875
3-chloro-N-(4-oxopentyl)-4-propan-2-yloxybenzamide (PubChem CID 143134875) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is 3-chloro-N-(4-oxopentyl)-4-propan-2-yloxybenzamide.
| Compound Name | 3-chloro-N-(4-oxopentyl)-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 143134875 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-chloro-N-(4-oxopentyl)-4-propan-2-yloxybenzamide |
| SMILES | CC(=O)CCCNC(=O)c1ccc(OC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClNO3/c1-10(2)20-14-7-6-12(9-13(14)16)15(19)17-8-4-5-11(3)18/h6-7,9-10H,4-5,8H2,1-3H3,(H,17,19) |
| InChIKey | DLNYJHGJQXLHNR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|