C31H48ClN3O4 — CID 143461416
3-chloro-N-(3-hydroxypropyl)-4-propan-2-yloxybenzamide;ethane;1-[methyl-[(Z)-2-(methylideneamino)-2-(4-methylphenyl)ethenyl]amino]propan-2-one (PubChem CID 143461416) has the molecular formula C31H48ClN3O4 and a molecular weight of 562.20 g/mol. Its IUPAC name is 3-chloro-N-(3-hydroxypropyl)-4-propan-2-yloxybenzamide;ethane;1-[methyl-[(Z)-2-(methylideneamino)-2-(4-methylphenyl)ethenyl]amino]propan-2-one.
| Compound Name | 3-chloro-N-(3-hydroxypropyl)-4-propan-2-yloxybenzamide;ethane;1-[methyl-[(Z)-2-(methylideneamino)-2-(4-methylphenyl)ethenyl]amino]propan-2-one |
|---|---|
| PubChem CID | 143461416 |
| Molecular Formula | C31H48ClN3O4 |
| Molecular Weight | 562.20 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | 3-chloro-N-(3-hydroxypropyl)-4-propan-2-yloxybenzamide;ethane;1-[methyl-[(Z)-2-(methylideneamino)-2-(4-methylphenyl)ethenyl]amino]propan-2-one |
| SMILES | C=N/C(=C\N(C)CC(C)=O)c1ccc(C)cc1.CC.CC.CC(C)Oc1ccc(C(=O)NCCCO)cc1Cl |
| InChI | InChI=1S/C14H18N2O.C13H18ClNO3.2C2H6/c1-11-5-7-13(8-6-11)14(15-3)10-16(4)9-12(2)17;1-9(2)18-12-5-4-10(8-11(12)14)13(17)15-6-3-7-16;2*1-2/h5-8,10H,3,9H2,1-2,4H3;4-5,8-9,16H,3,6-7H2,1-2H3,(H,15,17);2*1-2H3/b14-10-;;; |
| InChIKey | UCAMUUHTGBIPBP-POPHLXOKSA-N |
| XLogP | 6.81 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.20 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|