C40H65ClN2O3 — CID 143134874
3-chloro-N-(4-oxopentyl)-4-propan-2-yloxybenzamide;ethane;(Z)-2-ethyl-N-[(Z)-1-(4-methylphenyl)prop-1-enyl]hept-5-en-1-imine (PubChem CID 143134874) has the molecular formula C40H65ClN2O3 and a molecular weight of 657.42 g/mol. Its IUPAC name is 3-chloro-N-(4-oxopentyl)-4-propan-2-yloxybenzamide;ethane;(Z)-2-ethyl-N-[(Z)-1-(4-methylphenyl)prop-1-enyl]hept-5-en-1-imine.
| Compound Name | 3-chloro-N-(4-oxopentyl)-4-propan-2-yloxybenzamide;ethane;(Z)-2-ethyl-N-[(Z)-1-(4-methylphenyl)prop-1-enyl]hept-5-en-1-imine |
|---|---|
| PubChem CID | 143134874 |
| Molecular Formula | C40H65ClN2O3 |
| Molecular Weight | 657.42 g/mol |
| Exact Mass | 656.47 |
| IUPAC Name | 3-chloro-N-(4-oxopentyl)-4-propan-2-yloxybenzamide;ethane;(Z)-2-ethyl-N-[(Z)-1-(4-methylphenyl)prop-1-enyl]hept-5-en-1-imine |
| SMILES | C/C=C\CCC(/C=N/C(=C\C)c1ccc(C)cc1)CC.CC.CC.CC.CC(=O)CCCNC(=O)c1ccc(OC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C19H27N.C15H20ClNO3.3C2H6/c1-5-8-9-10-17(6-2)15-20-19(7-3)18-13-11-16(4)12-14-18;1-10(2)20-14-7-6-12(9-13(14)16)15(19)17-8-4-5-11(3)18;3*1-2/h5,7-8,11-15,17H,6,9-10H2,1-4H3;6-7,9-10H,4-5,8H2,1-3H3,(H,17,19);3*1-2H3/b8-5-,19-7-,20-15+;;;; |
| InChIKey | RENICAIGMGXMBP-MCCIFFIVSA-N |
| XLogP | 12.11 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.42 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|