C18H17Cl2NO3 — CID 18279335
(2-chloro-5-methylphenyl) 4-[(4-chlorobenzoyl)amino]butanoate (PubChem CID 18279335) has the molecular formula C18H17Cl2NO3 and a molecular weight of 366.24 g/mol. Its IUPAC name is (2-chloro-5-methylphenyl) 4-[(4-chlorobenzoyl)amino]butanoate.
| Compound Name | (2-chloro-5-methylphenyl) 4-[(4-chlorobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 18279335 |
| Molecular Formula | C18H17Cl2NO3 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | (2-chloro-5-methylphenyl) 4-[(4-chlorobenzoyl)amino]butanoate |
| SMILES | Cc1ccc(Cl)c(OC(=O)CCCNC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H17Cl2NO3/c1-12-4-9-15(20)16(11-12)24-17(22)3-2-10-21-18(23)13-5-7-14(19)8-6-13/h4-9,11H,2-3,10H2,1H3,(H,21,23) |
| InChIKey | QQWJFYKIHGXCOU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|