C25H28NO6PS — CID 178108581
5-[[(2-butoxycarbonylpyrrolidin-1-yl)-phenoxyphosphoryl]methyl]-1-benzothiophene-2-carboxylic acid (PubChem CID 178108581) has the molecular formula C25H28NO6PS and a molecular weight of 501.54 g/mol. Its IUPAC name is 5-[[(2-butoxycarbonylpyrrolidin-1-yl)-phenoxyphosphoryl]methyl]-1-benzothiophene-2-carboxylic acid.
| Compound Name | 5-[[(2-butoxycarbonylpyrrolidin-1-yl)-phenoxyphosphoryl]methyl]-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 178108581 |
| Molecular Formula | C25H28NO6PS |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 5-[[(2-butoxycarbonylpyrrolidin-1-yl)-phenoxyphosphoryl]methyl]-1-benzothiophene-2-carboxylic acid |
| SMILES | CCCCOC(=O)C1CCCN1P(=O)(Cc1ccc2sc(C(=O)O)cc2c1)Oc1ccccc1 |
| InChI | InChI=1S/C25H28NO6PS/c1-2-3-14-31-25(29)21-10-7-13-26(21)33(30,32-20-8-5-4-6-9-20)17-18-11-12-22-19(15-18)16-23(34-22)24(27)28/h4-6,8-9,11-12,15-16,21H,2-3,7,10,13-14,17H2,1H3,(H,27,28) |
| InChIKey | XNYIYWXECURVRX-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|