C24H41ClNO4P — CID 168741609
pentadecan-8-yl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]propanoate (PubChem CID 168741609) has the molecular formula C24H41ClNO4P and a molecular weight of 474.02 g/mol. Its IUPAC name is pentadecan-8-yl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]propanoate.
| Compound Name | pentadecan-8-yl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 168741609 |
| Molecular Formula | C24H41ClNO4P |
| Molecular Weight | 474.02 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | pentadecan-8-yl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]propanoate |
| SMILES | CCCCCCCC(CCCCCCC)OC(=O)[C@H](C)N[P@](=O)(Cl)Oc1ccccc1 |
| InChI | InChI=1S/C24H41ClNO4P/c1-4-6-8-10-13-17-22(18-14-11-9-7-5-2)29-24(27)21(3)26-31(25,28)30-23-19-15-12-16-20-23/h12,15-16,19-22H,4-11,13-14,17-18H2,1-3H3,(H,26,28)/t21-,31-/m0/s1 |
| InChIKey | BZRKCZQYBOLGOQ-BGOLNKOXSA-N |
| XLogP | 8.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.02 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|