C17H19ClNO4P — CID 155759130
benzyl (2S)-2-[[chloro-(4-methylphenoxy)phosphoryl]amino]propanoate (PubChem CID 155759130) has the molecular formula C17H19ClNO4P and a molecular weight of 367.77 g/mol. Its IUPAC name is benzyl (2S)-2-[[chloro-(4-methylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[chloro-(4-methylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 155759130 |
| Molecular Formula | C17H19ClNO4P |
| Molecular Weight | 367.77 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | benzyl (2S)-2-[[chloro-(4-methylphenoxy)phosphoryl]amino]propanoate |
| SMILES | Cc1ccc(OP(=O)(Cl)N[C@@H](C)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H19ClNO4P/c1-13-8-10-16(11-9-13)23-24(18,21)19-14(2)17(20)22-12-15-6-4-3-5-7-15/h3-11,14H,12H2,1-2H3,(H,19,21)/t14-,24?/m0/s1 |
| InChIKey | PHFHBKQIYHILAX-LNYMIDHXSA-N |
| XLogP | 4.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.77 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|