C26H25F5NO5P — CID 147580688
pentan-3-yl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]-3-phenylpropanoate (PubChem CID 147580688) has the molecular formula C26H25F5NO5P and a molecular weight of 557.45 g/mol. Its IUPAC name is pentan-3-yl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]-3-phenylpropanoate.
| Compound Name | pentan-3-yl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 147580688 |
| Molecular Formula | C26H25F5NO5P |
| Molecular Weight | 557.45 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | pentan-3-yl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]-3-phenylpropanoate |
| SMILES | CCC(CC)OC(=O)[C@H](Cc1ccccc1)N[P@](=O)(Oc1ccccc1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C26H25F5NO5P/c1-3-17(4-2)35-26(33)19(15-16-11-7-5-8-12-16)32-38(34,36-18-13-9-6-10-14-18)37-25-23(30)21(28)20(27)22(29)24(25)31/h5-14,17,19H,3-4,15H2,1-2H3,(H,32,34)/t19-,38-/m0/s1 |
| InChIKey | FWIZWMSNNXNMKZ-YELMDFBASA-N |
| XLogP | 6.88 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.45 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|