C32H36F5N2O6P — CID 175712938
tert-butyl (2S)-2-[[[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-phenylpropan-2-yl]amino]-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]-3-phenylpropanoate (PubChem CID 175712938) has the molecular formula C32H36F5N2O6P and a molecular weight of 670.61 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-phenylpropan-2-yl]amino]-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]-3-phenylpropanoate.
| Compound Name | tert-butyl (2S)-2-[[[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-phenylpropan-2-yl]amino]-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 175712938 |
| Molecular Formula | C32H36F5N2O6P |
| Molecular Weight | 670.61 g/mol |
| Exact Mass | 670.22 |
| IUPAC Name | tert-butyl (2S)-2-[[[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-phenylpropan-2-yl]amino]-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccccc1)NP(=O)(N[C@@H](Cc1ccccc1)C(=O)OC(C)(C)C)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C32H36F5N2O6P/c1-31(2,3)43-29(40)21(17-19-13-9-7-10-14-19)38-46(42,45-28-26(36)24(34)23(33)25(35)27(28)37)39-22(30(41)44-32(4,5)6)18-20-15-11-8-12-16-20/h7-16,21-22H,17-18H2,1-6H3,(H2,38,39,42)/t21-,22-/m0/s1 |
| InChIKey | WSSFQUOYRXZSGU-VXKWHMMOSA-N |
| XLogP | 6.95 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.61 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|