C45H50N3O8P — CID 59132384
ethyl (2S)-2-[[phenoxy-[[4-[[(4R,5S,6S,7R)-1,3,7-tribenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-4-yl]methyl]phenoxy]methyl]phosphoryl]amino]propanoate (PubChem CID 59132384) has the molecular formula C45H50N3O8P and a molecular weight of 791.88 g/mol. Its IUPAC name is ethyl (2S)-2-[[phenoxy-[[4-[[(4R,5S,6S,7R)-1,3,7-tribenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-4-yl]methyl]phenoxy]methyl]phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[phenoxy-[[4-[[(4R,5S,6S,7R)-1,3,7-tribenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-4-yl]methyl]phenoxy]methyl]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 59132384 |
| Molecular Formula | C45H50N3O8P |
| Molecular Weight | 791.88 g/mol |
| Exact Mass | 791.33 |
| IUPAC Name | ethyl (2S)-2-[[phenoxy-[[4-[[(4R,5S,6S,7R)-1,3,7-tribenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-4-yl]methyl]phenoxy]methyl]phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(COc1ccc(C[C@@H]2[C@H](O)[C@@H](O)[C@@H](Cc3ccccc3)N(Cc3ccccc3)C(=O)N2Cc2ccccc2)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C45H50N3O8P/c1-3-54-44(51)33(2)46-57(53,56-39-22-14-7-15-23-39)32-55-38-26-24-35(25-27-38)29-41-43(50)42(49)40(28-34-16-8-4-9-17-34)47(30-36-18-10-5-11-19-36)45(52)48(41)31-37-20-12-6-13-21-37/h4-27,33,40-43,49-50H,3,28-32H2,1-2H3,(H,46,53)/t33-,40+,41+,42-,43-,57?/m0/s1 |
| InChIKey | BPVNNXHYVYARML-LUYJGDEISA-N |
| XLogP | 7.22 |
| TPSA | 137.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.88 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|