C41H40N2O6 — CID 142824562
3-[[(5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-2-oxo-3-[(4-phenylmethoxyphenyl)methyl]-1,3-diazepan-1-yl]methyl]benzoic acid (PubChem CID 142824562) has the molecular formula C41H40N2O6 and a molecular weight of 656.78 g/mol. Its IUPAC name is 3-[[(5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-2-oxo-3-[(4-phenylmethoxyphenyl)methyl]-1,3-diazepan-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[(5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-2-oxo-3-[(4-phenylmethoxyphenyl)methyl]-1,3-diazepan-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 142824562 |
| Molecular Formula | C41H40N2O6 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.29 |
| IUPAC Name | 3-[[(5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-2-oxo-3-[(4-phenylmethoxyphenyl)methyl]-1,3-diazepan-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2C(=O)N(Cc3ccc(OCc4ccccc4)cc3)C(Cc3ccccc3)[C@H](O)[C@@H](O)[C@H]2Cc2ccccc2)c1 |
| InChI | InChI=1S/C41H40N2O6/c44-38-36(24-29-11-4-1-5-12-29)42(26-31-19-21-35(22-20-31)49-28-32-15-8-3-9-16-32)41(48)43(27-33-17-10-18-34(23-33)40(46)47)37(39(38)45)25-30-13-6-2-7-14-30/h1-23,36-39,44-45H,24-28H2,(H,46,47)/t36?,37-,38+,39+/m1/s1 |
| InChIKey | LQTRONGSULFMSA-CLYCCFDPSA-N |
| XLogP | 6.35 |
| TPSA | 110.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |