C41H41N5O4 — CID 16729970
(4R,5S,6S,7R)-1-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-3-[(4-phenylmethoxyphenyl)methyl]-1,3-diazepan-2-one (PubChem CID 16729970) has the molecular formula C41H41N5O4 and a molecular weight of 667.81 g/mol. Its IUPAC name is (4R,5S,6S,7R)-1-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-3-[(4-phenylmethoxyphenyl)methyl]-1,3-diazepan-2-one.
| Compound Name | (4R,5S,6S,7R)-1-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-3-[(4-phenylmethoxyphenyl)methyl]-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 16729970 |
| Molecular Formula | C41H41N5O4 |
| Molecular Weight | 667.81 g/mol |
| Exact Mass | 667.32 |
| IUPAC Name | (4R,5S,6S,7R)-1-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-3-[(4-phenylmethoxyphenyl)methyl]-1,3-diazepan-2-one |
| SMILES | Nc1n[nH]c2ccc(CN3C(=O)N(Cc4ccc(OCc5ccccc5)cc4)[C@H](Cc4ccccc4)[C@H](O)[C@@H](O)[C@H]3Cc3ccccc3)cc12 |
| InChI | InChI=1S/C41H41N5O4/c42-40-34-22-32(18-21-35(34)43-44-40)26-46-37(24-29-12-6-2-7-13-29)39(48)38(47)36(23-28-10-4-1-5-11-28)45(41(46)49)25-30-16-19-33(20-17-30)50-27-31-14-8-3-9-15-31/h1-22,36-39,47-48H,23-27H2,(H3,42,43,44)/t36-,37-,38+,39+/m1/s1 |
| InChIKey | IFWFHSCJJDPRGB-AJWAGCPHSA-N |
| XLogP | 6.11 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.81 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |