C40H45N5O4 — CID 70930673
(3aS,8R,8aS)-7-[(3-amino-1H-indazol-5-yl)methyl]-8-benzyl-5-[(3-butoxyphenyl)methyl]-2,2-dimethyl-4-phenyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one (PubChem CID 70930673) has the molecular formula C40H45N5O4 and a molecular weight of 659.83 g/mol. Its IUPAC name is (3aS,8R,8aS)-7-[(3-amino-1H-indazol-5-yl)methyl]-8-benzyl-5-[(3-butoxyphenyl)methyl]-2,2-dimethyl-4-phenyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one.
| Compound Name | (3aS,8R,8aS)-7-[(3-amino-1H-indazol-5-yl)methyl]-8-benzyl-5-[(3-butoxyphenyl)methyl]-2,2-dimethyl-4-phenyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one |
|---|---|
| PubChem CID | 70930673 |
| Molecular Formula | C40H45N5O4 |
| Molecular Weight | 659.83 g/mol |
| Exact Mass | 659.35 |
| IUPAC Name | (3aS,8R,8aS)-7-[(3-amino-1H-indazol-5-yl)methyl]-8-benzyl-5-[(3-butoxyphenyl)methyl]-2,2-dimethyl-4-phenyl-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one |
| SMILES | CCCCOc1cccc(CN2C(=O)N(Cc3ccc4[nH]nc(N)c4c3)[C@H](Cc3ccccc3)[C@@H]3OC(C)(C)O[C@H]3C2c2ccccc2)c1 |
| InChI | InChI=1S/C40H45N5O4/c1-4-5-21-47-31-18-12-15-28(22-31)26-45-35(30-16-10-7-11-17-30)37-36(48-40(2,3)49-37)34(24-27-13-8-6-9-14-27)44(39(45)46)25-29-19-20-33-32(23-29)38(41)43-42-33/h6-20,22-23,34-37H,4-5,21,24-26H2,1-3H3,(H3,41,42,43)/t34-,35?,36+,37+/m1/s1 |
| InChIKey | YDMYYPKWUASBGR-SUECKSNHSA-N |
| XLogP | 7.63 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.83 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|