C55H62N2O9 — CID 10629549
(4R,5S,6S,7R)-4,7-dibenzyl-5,6-bis(2-methoxyethoxymethoxy)-1,3-bis[(4-phenylmethoxyphenyl)methyl]-1,3-diazepan-2-one (PubChem CID 10629549) has the molecular formula C55H62N2O9 and a molecular weight of 895.11 g/mol. Its IUPAC name is (4R,5S,6S,7R)-4,7-dibenzyl-5,6-bis(2-methoxyethoxymethoxy)-1,3-bis[(4-phenylmethoxyphenyl)methyl]-1,3-diazepan-2-one.
| Compound Name | (4R,5S,6S,7R)-4,7-dibenzyl-5,6-bis(2-methoxyethoxymethoxy)-1,3-bis[(4-phenylmethoxyphenyl)methyl]-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 10629549 |
| Molecular Formula | C55H62N2O9 |
| Molecular Weight | 895.11 g/mol |
| Exact Mass | 894.45 |
| IUPAC Name | (4R,5S,6S,7R)-4,7-dibenzyl-5,6-bis(2-methoxyethoxymethoxy)-1,3-bis[(4-phenylmethoxyphenyl)methyl]-1,3-diazepan-2-one |
| SMILES | COCCOCO[C@@H]1[C@@H](OCOCCOC)[C@@H](Cc2ccccc2)N(Cc2ccc(OCc3ccccc3)cc2)C(=O)N(Cc2ccc(OCc3ccccc3)cc2)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C55H62N2O9/c1-59-31-33-61-41-65-53-51(35-43-15-7-3-8-16-43)56(37-45-23-27-49(28-24-45)63-39-47-19-11-5-12-20-47)55(58)57(38-46-25-29-50(30-26-46)64-40-48-21-13-6-14-22-48)52(36-44-17-9-4-10-18-44)54(53)66-42-62-34-32-60-2/h3-30,51-54H,31-42H2,1-2H3/t51-,52-,53+,54+/m1/s1 |
| InChIKey | HOALPMZNBNHTOH-ZJQYSRSLSA-N |
| XLogP | 9.52 |
| TPSA | 97.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.11 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|